C21H24Cl2N2O4 — CID 110567950
3-(2,4-dichlorophenyl)-4-[3-(hydroxymethyl)piperidin-1-yl]-1-(oxolan-2-ylmethyl)pyrrole-2,5-dione (PubChem CID 110567950) has the molecular formula C21H24Cl2N2O4 and a molecular weight of 439.34 g/mol. Its IUPAC name is 3-(2,4-dichlorophenyl)-4-[3-(hydroxymethyl)piperidin-1-yl]-1-(oxolan-2-ylmethyl)pyrrole-2,5-dione.
| Compound Name | 3-(2,4-dichlorophenyl)-4-[3-(hydroxymethyl)piperidin-1-yl]-1-(oxolan-2-ylmethyl)pyrrole-2,5-dione |
|---|---|
| PubChem CID | 110567950 |
| Molecular Formula | C21H24Cl2N2O4 |
| Molecular Weight | 439.34 g/mol |
| Exact Mass | 438.11 |
| IUPAC Name | 3-(2,4-dichlorophenyl)-4-[3-(hydroxymethyl)piperidin-1-yl]-1-(oxolan-2-ylmethyl)pyrrole-2,5-dione |
| SMILES | O=C1C(c2ccc(Cl)cc2Cl)=C(N2CCCC(CO)C2)C(=O)N1CC1CCCO1 |
| InChI | InChI=1S/C21H24Cl2N2O4/c22-14-5-6-16(17(23)9-14)18-19(24-7-1-3-13(10-24)12-26)21(28)25(20(18)27)11-15-4-2-8-29-15/h5-6,9,13,15,26H,1-4,7-8,10-12H2 |
| InChIKey | FVDXEKHCSNLHMO-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 70.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.34 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|