C19H19ClN2O2 — CID 11057018
2-benzyl-4-chloro-6,7-diethoxyquinazoline (PubChem CID 11057018) has the molecular formula C19H19ClN2O2 and a molecular weight of 342.83 g/mol. Its IUPAC name is 2-benzyl-4-chloro-6,7-diethoxyquinazoline.
| Compound Name | 2-benzyl-4-chloro-6,7-diethoxyquinazoline |
|---|---|
| PubChem CID | 11057018 |
| Molecular Formula | C19H19ClN2O2 |
| Molecular Weight | 342.83 g/mol |
| Exact Mass | 342.11 |
| IUPAC Name | 2-benzyl-4-chloro-6,7-diethoxyquinazoline |
| SMILES | CCOc1cc2nc(Cc3ccccc3)nc(Cl)c2cc1OCC |
| InChI | InChI=1S/C19H19ClN2O2/c1-3-23-16-11-14-15(12-17(16)24-4-2)21-18(22-19(14)20)10-13-8-6-5-7-9-13/h5-9,11-12H,3-4,10H2,1-2H3 |
| InChIKey | VMRIQIYXQSUZOJ-UHFFFAOYSA-N |
| XLogP | 4.67 |
| TPSA | 44.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.83 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |