C26H29N3O4 — CID 110578219
1-(1,3-benzodioxol-5-yl)-3-(2,4-dimethylphenyl)-4-[methyl-(1-methylpiperidin-4-yl)amino]pyrrole-2,5-dione (PubChem CID 110578219) has the molecular formula C26H29N3O4 and a molecular weight of 447.54 g/mol. Its IUPAC name is 1-(1,3-benzodioxol-5-yl)-3-(2,4-dimethylphenyl)-4-[methyl-(1-methylpiperidin-4-yl)amino]pyrrole-2,5-dione.
| Compound Name | 1-(1,3-benzodioxol-5-yl)-3-(2,4-dimethylphenyl)-4-[methyl-(1-methylpiperidin-4-yl)amino]pyrrole-2,5-dione |
|---|---|
| PubChem CID | 110578219 |
| Molecular Formula | C26H29N3O4 |
| Molecular Weight | 447.54 g/mol |
| Exact Mass | 447.22 |
| IUPAC Name | 1-(1,3-benzodioxol-5-yl)-3-(2,4-dimethylphenyl)-4-[methyl-(1-methylpiperidin-4-yl)amino]pyrrole-2,5-dione |
| SMILES | Cc1ccc(C2=C(N(C)C3CCN(C)CC3)C(=O)N(c3ccc4c(c3)OCO4)C2=O)c(C)c1 |
| InChI | InChI=1S/C26H29N3O4/c1-16-5-7-20(17(2)13-16)23-24(28(4)18-9-11-27(3)12-10-18)26(31)29(25(23)30)19-6-8-21-22(14-19)33-15-32-21/h5-8,13-14,18H,9-12,15H2,1-4H3 |
| InChIKey | DZORXZURGCVKAN-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 62.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.54 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|