C22H19NO3S — CID 11057921
S-phenyl (2S,3S)-3-benzamido-2-hydroxy-3-phenylpropanethioate (PubChem CID 11057921) has the molecular formula C22H19NO3S and a molecular weight of 377.47 g/mol. Its IUPAC name is S-phenyl (2S,3S)-3-benzamido-2-hydroxy-3-phenylpropanethioate.
| Compound Name | S-phenyl (2S,3S)-3-benzamido-2-hydroxy-3-phenylpropanethioate |
|---|---|
| PubChem CID | 11057921 |
| Molecular Formula | C22H19NO3S |
| Molecular Weight | 377.47 g/mol |
| Exact Mass | 377.11 |
| IUPAC Name | S-phenyl (2S,3S)-3-benzamido-2-hydroxy-3-phenylpropanethioate |
| SMILES | O=C(N[C@@H](c1ccccc1)[C@H](O)C(=O)Sc1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C22H19NO3S/c24-20(22(26)27-18-14-8-3-9-15-18)19(16-10-4-1-5-11-16)23-21(25)17-12-6-2-7-13-17/h1-15,19-20,24H,(H,23,25)/t19-,20-/m0/s1 |
| InChIKey | BIEFEVBLTQTGJV-PMACEKPBSA-N |
| XLogP | 3.84 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.47 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|