C20H18ClNO4 — CID 110583763
3-chloro-4-(3,4-dimethoxyphenyl)-1-(2,4-dimethylphenyl)pyrrole-2,5-dione (PubChem CID 110583763) has the molecular formula C20H18ClNO4 and a molecular weight of 371.82 g/mol. Its IUPAC name is 3-chloro-4-(3,4-dimethoxyphenyl)-1-(2,4-dimethylphenyl)pyrrole-2,5-dione.
| Compound Name | 3-chloro-4-(3,4-dimethoxyphenyl)-1-(2,4-dimethylphenyl)pyrrole-2,5-dione |
|---|---|
| PubChem CID | 110583763 |
| Molecular Formula | C20H18ClNO4 |
| Molecular Weight | 371.82 g/mol |
| Exact Mass | 371.09 |
| IUPAC Name | 3-chloro-4-(3,4-dimethoxyphenyl)-1-(2,4-dimethylphenyl)pyrrole-2,5-dione |
| SMILES | COc1ccc(C2=C(Cl)C(=O)N(c3ccc(C)cc3C)C2=O)cc1OC |
| InChI | InChI=1S/C20H18ClNO4/c1-11-5-7-14(12(2)9-11)22-19(23)17(18(21)20(22)24)13-6-8-15(25-3)16(10-13)26-4/h5-10H,1-4H3 |
| InChIKey | XTESJVMSCFTVLI-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.82 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|