C21H20ClNO3 — CID 110584537
3-chloro-1-(2,4-dimethylphenyl)-4-(4-propan-2-yloxyphenyl)pyrrole-2,5-dione (PubChem CID 110584537) has the molecular formula C21H20ClNO3 and a molecular weight of 369.85 g/mol. Its IUPAC name is 3-chloro-1-(2,4-dimethylphenyl)-4-(4-propan-2-yloxyphenyl)pyrrole-2,5-dione.
| Compound Name | 3-chloro-1-(2,4-dimethylphenyl)-4-(4-propan-2-yloxyphenyl)pyrrole-2,5-dione |
|---|---|
| PubChem CID | 110584537 |
| Molecular Formula | C21H20ClNO3 |
| Molecular Weight | 369.85 g/mol |
| Exact Mass | 369.11 |
| IUPAC Name | 3-chloro-1-(2,4-dimethylphenyl)-4-(4-propan-2-yloxyphenyl)pyrrole-2,5-dione |
| SMILES | Cc1ccc(N2C(=O)C(Cl)=C(c3ccc(OC(C)C)cc3)C2=O)c(C)c1 |
| InChI | InChI=1S/C21H20ClNO3/c1-12(2)26-16-8-6-15(7-9-16)18-19(22)21(25)23(20(18)24)17-10-5-13(3)11-14(17)4/h5-12H,1-4H3 |
| InChIKey | ROSJUMWLHFHYSD-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.85 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|