C20H15ClF3NO3 — CID 110584545
3-chloro-4-(4-propan-2-yloxyphenyl)-1-[4-(trifluoromethyl)phenyl]pyrrole-2,5-dione (PubChem CID 110584545) has the molecular formula C20H15ClF3NO3 and a molecular weight of 409.79 g/mol. Its IUPAC name is 3-chloro-4-(4-propan-2-yloxyphenyl)-1-[4-(trifluoromethyl)phenyl]pyrrole-2,5-dione.
| Compound Name | 3-chloro-4-(4-propan-2-yloxyphenyl)-1-[4-(trifluoromethyl)phenyl]pyrrole-2,5-dione |
|---|---|
| PubChem CID | 110584545 |
| Molecular Formula | C20H15ClF3NO3 |
| Molecular Weight | 409.79 g/mol |
| Exact Mass | 409.07 |
| IUPAC Name | 3-chloro-4-(4-propan-2-yloxyphenyl)-1-[4-(trifluoromethyl)phenyl]pyrrole-2,5-dione |
| SMILES | CC(C)Oc1ccc(C2=C(Cl)C(=O)N(c3ccc(C(F)(F)F)cc3)C2=O)cc1 |
| InChI | InChI=1S/C20H15ClF3NO3/c1-11(2)28-15-9-3-12(4-10-15)16-17(21)19(27)25(18(16)26)14-7-5-13(6-8-14)20(22,23)24/h3-11H,1-2H3 |
| InChIKey | SWSIGSXESDWAKP-UHFFFAOYSA-N |
| XLogP | 5.02 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.79 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|