C24H27ClN2O5 — CID 110590110
3-(3-chloro-4-methoxyanilino)-1-(2-methoxyethyl)-4-[4-(2-methylpropoxy)phenyl]pyrrole-2,5-dione (PubChem CID 110590110) has the molecular formula C24H27ClN2O5 and a molecular weight of 458.94 g/mol. Its IUPAC name is 3-(3-chloro-4-methoxyanilino)-1-(2-methoxyethyl)-4-[4-(2-methylpropoxy)phenyl]pyrrole-2,5-dione.
| Compound Name | 3-(3-chloro-4-methoxyanilino)-1-(2-methoxyethyl)-4-[4-(2-methylpropoxy)phenyl]pyrrole-2,5-dione |
|---|---|
| PubChem CID | 110590110 |
| Molecular Formula | C24H27ClN2O5 |
| Molecular Weight | 458.94 g/mol |
| Exact Mass | 458.16 |
| IUPAC Name | 3-(3-chloro-4-methoxyanilino)-1-(2-methoxyethyl)-4-[4-(2-methylpropoxy)phenyl]pyrrole-2,5-dione |
| SMILES | COCCN1C(=O)C(Nc2ccc(OC)c(Cl)c2)=C(c2ccc(OCC(C)C)cc2)C1=O |
| InChI | InChI=1S/C24H27ClN2O5/c1-15(2)14-32-18-8-5-16(6-9-18)21-22(24(29)27(23(21)28)11-12-30-3)26-17-7-10-20(31-4)19(25)13-17/h5-10,13,15,26H,11-12,14H2,1-4H3 |
| InChIKey | FCNWSMATBUAUFR-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 77.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.94 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|