C21H14F3N3O3S — CID 110590733
1-(pyridin-4-ylmethyl)-3-thiophen-2-yl-4-[4-(trifluoromethoxy)anilino]pyrrole-2,5-dione (PubChem CID 110590733) has the molecular formula C21H14F3N3O3S and a molecular weight of 445.42 g/mol. Its IUPAC name is 1-(pyridin-4-ylmethyl)-3-thiophen-2-yl-4-[4-(trifluoromethoxy)anilino]pyrrole-2,5-dione.
| Compound Name | 1-(pyridin-4-ylmethyl)-3-thiophen-2-yl-4-[4-(trifluoromethoxy)anilino]pyrrole-2,5-dione |
|---|---|
| PubChem CID | 110590733 |
| Molecular Formula | C21H14F3N3O3S |
| Molecular Weight | 445.42 g/mol |
| Exact Mass | 445.07 |
| IUPAC Name | 1-(pyridin-4-ylmethyl)-3-thiophen-2-yl-4-[4-(trifluoromethoxy)anilino]pyrrole-2,5-dione |
| SMILES | O=C1C(Nc2ccc(OC(F)(F)F)cc2)=C(c2cccs2)C(=O)N1Cc1ccncc1 |
| InChI | InChI=1S/C21H14F3N3O3S/c22-21(23,24)30-15-5-3-14(4-6-15)26-18-17(16-2-1-11-31-16)19(28)27(20(18)29)12-13-7-9-25-10-8-13/h1-11,26H,12H2 |
| InChIKey | UTSHNQCWGZRLIQ-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 71.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.42 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|