C18H13F3N2O3S — CID 110591110
1-prop-2-enyl-3-thiophen-2-yl-4-[3-(trifluoromethoxy)anilino]pyrrole-2,5-dione (PubChem CID 110591110) has the molecular formula C18H13F3N2O3S and a molecular weight of 394.37 g/mol. Its IUPAC name is 1-prop-2-enyl-3-thiophen-2-yl-4-[3-(trifluoromethoxy)anilino]pyrrole-2,5-dione.
| Compound Name | 1-prop-2-enyl-3-thiophen-2-yl-4-[3-(trifluoromethoxy)anilino]pyrrole-2,5-dione |
|---|---|
| PubChem CID | 110591110 |
| Molecular Formula | C18H13F3N2O3S |
| Molecular Weight | 394.37 g/mol |
| Exact Mass | 394.06 |
| IUPAC Name | 1-prop-2-enyl-3-thiophen-2-yl-4-[3-(trifluoromethoxy)anilino]pyrrole-2,5-dione |
| SMILES | C=CCN1C(=O)C(Nc2cccc(OC(F)(F)F)c2)=C(c2cccs2)C1=O |
| InChI | InChI=1S/C18H13F3N2O3S/c1-2-8-23-16(24)14(13-7-4-9-27-13)15(17(23)25)22-11-5-3-6-12(10-11)26-18(19,20)21/h2-7,9-10,22H,1,8H2 |
| InChIKey | UNPDUNLFNHWADH-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.37 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|