C21H17ClF5NO3 — CID 11059595
ethyl 2-(3-chloro-1,2,2,3,3-pentafluoropropyl)-3-(4-methoxyphenyl)indolizine-1-carboxylate (PubChem CID 11059595) has the molecular formula C21H17ClF5NO3 and a molecular weight of 461.81 g/mol. Its IUPAC name is ethyl 2-(3-chloro-1,2,2,3,3-pentafluoropropyl)-3-(4-methoxyphenyl)indolizine-1-carboxylate.
| Compound Name | ethyl 2-(3-chloro-1,2,2,3,3-pentafluoropropyl)-3-(4-methoxyphenyl)indolizine-1-carboxylate |
|---|---|
| PubChem CID | 11059595 |
| Molecular Formula | C21H17ClF5NO3 |
| Molecular Weight | 461.81 g/mol |
| Exact Mass | 461.08 |
| IUPAC Name | ethyl 2-(3-chloro-1,2,2,3,3-pentafluoropropyl)-3-(4-methoxyphenyl)indolizine-1-carboxylate |
| SMILES | CCOC(=O)c1c(C(F)C(F)(F)C(F)(F)Cl)c(-c2ccc(OC)cc2)n2ccccc12 |
| InChI | InChI=1S/C21H17ClF5NO3/c1-3-31-19(29)15-14-6-4-5-11-28(14)17(12-7-9-13(30-2)10-8-12)16(15)18(23)20(24,25)21(22,26)27/h4-11,18H,3H2,1-2H3 |
| InChIKey | QRAPTIJSFKVWIQ-UHFFFAOYSA-N |
| XLogP | 6.27 |
| TPSA | 39.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.81 |
| LogP ≤ 5 | 6.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|