C17H14Br2F3NO — CID 11059659
N-[3-(bromomethyl)phenyl]-N-[[3-(bromomethyl)phenyl]methyl]-2,2,2-trifluoroacetamide (PubChem CID 11059659) has the molecular formula C17H14Br2F3NO and a molecular weight of 465.11 g/mol. Its IUPAC name is N-[3-(bromomethyl)phenyl]-N-[[3-(bromomethyl)phenyl]methyl]-2,2,2-trifluoroacetamide.
| Compound Name | N-[3-(bromomethyl)phenyl]-N-[[3-(bromomethyl)phenyl]methyl]-2,2,2-trifluoroacetamide |
|---|---|
| PubChem CID | 11059659 |
| Molecular Formula | C17H14Br2F3NO |
| Molecular Weight | 465.11 g/mol |
| Exact Mass | 462.94 |
| IUPAC Name | N-[3-(bromomethyl)phenyl]-N-[[3-(bromomethyl)phenyl]methyl]-2,2,2-trifluoroacetamide |
| SMILES | O=C(N(Cc1cccc(CBr)c1)c1cccc(CBr)c1)C(F)(F)F |
| InChI | InChI=1S/C17H14Br2F3NO/c18-9-12-3-1-5-14(7-12)11-23(16(24)17(20,21)22)15-6-2-4-13(8-15)10-19/h1-8H,9-11H2 |
| InChIKey | PRNUYFLGLAMBNL-UHFFFAOYSA-N |
| XLogP | 5.57 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.11 |
| LogP ≤ 5 | 5.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|