C24H27Cl2N3O2 — CID 110598890
3-(2,4-dichlorophenyl)-4-[4-(diethylamino)anilino]-1-(2-methylpropyl)pyrrole-2,5-dione (PubChem CID 110598890) has the molecular formula C24H27Cl2N3O2 and a molecular weight of 460.41 g/mol. Its IUPAC name is 3-(2,4-dichlorophenyl)-4-[4-(diethylamino)anilino]-1-(2-methylpropyl)pyrrole-2,5-dione.
| Compound Name | 3-(2,4-dichlorophenyl)-4-[4-(diethylamino)anilino]-1-(2-methylpropyl)pyrrole-2,5-dione |
|---|---|
| PubChem CID | 110598890 |
| Molecular Formula | C24H27Cl2N3O2 |
| Molecular Weight | 460.41 g/mol |
| Exact Mass | 459.15 |
| IUPAC Name | 3-(2,4-dichlorophenyl)-4-[4-(diethylamino)anilino]-1-(2-methylpropyl)pyrrole-2,5-dione |
| SMILES | CCN(CC)c1ccc(NC2=C(c3ccc(Cl)cc3Cl)C(=O)N(CC(C)C)C2=O)cc1 |
| InChI | InChI=1S/C24H27Cl2N3O2/c1-5-28(6-2)18-10-8-17(9-11-18)27-22-21(19-12-7-16(25)13-20(19)26)23(30)29(24(22)31)14-15(3)4/h7-13,15,27H,5-6,14H2,1-4H3 |
| InChIKey | VRKHOXPCKCAXAA-UHFFFAOYSA-N |
| XLogP | 5.69 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.41 |
| LogP ≤ 5 | 5.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|