C21H19Cl3N2O3 — CID 110598897
3-(3-chloro-4-methoxyanilino)-4-(2,4-dichlorophenyl)-1-(2-methylpropyl)pyrrole-2,5-dione (PubChem CID 110598897) has the molecular formula C21H19Cl3N2O3 and a molecular weight of 453.75 g/mol. Its IUPAC name is 3-(3-chloro-4-methoxyanilino)-4-(2,4-dichlorophenyl)-1-(2-methylpropyl)pyrrole-2,5-dione.
| Compound Name | 3-(3-chloro-4-methoxyanilino)-4-(2,4-dichlorophenyl)-1-(2-methylpropyl)pyrrole-2,5-dione |
|---|---|
| PubChem CID | 110598897 |
| Molecular Formula | C21H19Cl3N2O3 |
| Molecular Weight | 453.75 g/mol |
| Exact Mass | 452.05 |
| IUPAC Name | 3-(3-chloro-4-methoxyanilino)-4-(2,4-dichlorophenyl)-1-(2-methylpropyl)pyrrole-2,5-dione |
| SMILES | COc1ccc(NC2=C(c3ccc(Cl)cc3Cl)C(=O)N(CC(C)C)C2=O)cc1Cl |
| InChI | InChI=1S/C21H19Cl3N2O3/c1-11(2)10-26-20(27)18(14-6-4-12(22)8-15(14)23)19(21(26)28)25-13-5-7-17(29-3)16(24)9-13/h4-9,11,25H,10H2,1-3H3 |
| InChIKey | MLTWBYOOWSMTQA-UHFFFAOYSA-N |
| XLogP | 5.50 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.75 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|