C20H18Cl2N2O2 — CID 110598907
3-anilino-4-(2,4-dichlorophenyl)-1-(2-methylpropyl)pyrrole-2,5-dione (PubChem CID 110598907) has the molecular formula C20H18Cl2N2O2 and a molecular weight of 389.28 g/mol. Its IUPAC name is 3-anilino-4-(2,4-dichlorophenyl)-1-(2-methylpropyl)pyrrole-2,5-dione.
| Compound Name | 3-anilino-4-(2,4-dichlorophenyl)-1-(2-methylpropyl)pyrrole-2,5-dione |
|---|---|
| PubChem CID | 110598907 |
| Molecular Formula | C20H18Cl2N2O2 |
| Molecular Weight | 389.28 g/mol |
| Exact Mass | 388.07 |
| IUPAC Name | 3-anilino-4-(2,4-dichlorophenyl)-1-(2-methylpropyl)pyrrole-2,5-dione |
| SMILES | CC(C)CN1C(=O)C(Nc2ccccc2)=C(c2ccc(Cl)cc2Cl)C1=O |
| InChI | InChI=1S/C20H18Cl2N2O2/c1-12(2)11-24-19(25)17(15-9-8-13(21)10-16(15)22)18(20(24)26)23-14-6-4-3-5-7-14/h3-10,12,23H,11H2,1-2H3 |
| InChIKey | LQTITWXVXLDNAZ-UHFFFAOYSA-N |
| XLogP | 4.84 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.28 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|