C21H18Cl2N2O2 — CID 110598932
3-(2,4-dichlorophenyl)-4-(2,3-dimethylanilino)-1-prop-2-enylpyrrole-2,5-dione (PubChem CID 110598932) has the molecular formula C21H18Cl2N2O2 and a molecular weight of 401.29 g/mol. Its IUPAC name is 3-(2,4-dichlorophenyl)-4-(2,3-dimethylanilino)-1-prop-2-enylpyrrole-2,5-dione.
| Compound Name | 3-(2,4-dichlorophenyl)-4-(2,3-dimethylanilino)-1-prop-2-enylpyrrole-2,5-dione |
|---|---|
| PubChem CID | 110598932 |
| Molecular Formula | C21H18Cl2N2O2 |
| Molecular Weight | 401.29 g/mol |
| Exact Mass | 400.07 |
| IUPAC Name | 3-(2,4-dichlorophenyl)-4-(2,3-dimethylanilino)-1-prop-2-enylpyrrole-2,5-dione |
| SMILES | C=CCN1C(=O)C(Nc2cccc(C)c2C)=C(c2ccc(Cl)cc2Cl)C1=O |
| InChI | InChI=1S/C21H18Cl2N2O2/c1-4-10-25-20(26)18(15-9-8-14(22)11-16(15)23)19(21(25)27)24-17-7-5-6-12(2)13(17)3/h4-9,11,24H,1,10H2,2-3H3 |
| InChIKey | WVNDKHUDIHLGRC-UHFFFAOYSA-N |
| XLogP | 4.99 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.29 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|