C20H29ClN2O3 — CID 110601429
tert-butyl 4-[[[2-(4-chlorophenyl)acetyl]-methylamino]methyl]piperidine-1-carboxylate (PubChem CID 110601429) has the molecular formula C20H29ClN2O3 and a molecular weight of 380.92 g/mol. Its IUPAC name is tert-butyl 4-[[[2-(4-chlorophenyl)acetyl]-methylamino]methyl]piperidine-1-carboxylate.
| Compound Name | tert-butyl 4-[[[2-(4-chlorophenyl)acetyl]-methylamino]methyl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 110601429 |
| Molecular Formula | C20H29ClN2O3 |
| Molecular Weight | 380.92 g/mol |
| Exact Mass | 380.19 |
| IUPAC Name | tert-butyl 4-[[[2-(4-chlorophenyl)acetyl]-methylamino]methyl]piperidine-1-carboxylate |
| SMILES | CN(CC1CCN(C(=O)OC(C)(C)C)CC1)C(=O)Cc1ccc(Cl)cc1 |
| InChI | InChI=1S/C20H29ClN2O3/c1-20(2,3)26-19(25)23-11-9-16(10-12-23)14-22(4)18(24)13-15-5-7-17(21)8-6-15/h5-8,16H,9-14H2,1-4H3 |
| InChIKey | ICFOBYPZRQWFTM-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.92 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |