C30H40O5S — CID 11060314
(2E,4S,5R,9S,10Z,12R)-4,10-dimethyl-12-methylsulfonyl-5,9-bis(phenylmethoxy)trideca-2,10-dien-7-one (PubChem CID 11060314) has the molecular formula C30H40O5S and a molecular weight of 512.71 g/mol. Its IUPAC name is (2E,4S,5R,9S,10Z,12R)-4,10-dimethyl-12-methylsulfonyl-5,9-bis(phenylmethoxy)trideca-2,10-dien-7-one.
| Compound Name | (2E,4S,5R,9S,10Z,12R)-4,10-dimethyl-12-methylsulfonyl-5,9-bis(phenylmethoxy)trideca-2,10-dien-7-one |
|---|---|
| PubChem CID | 11060314 |
| Molecular Formula | C30H40O5S |
| Molecular Weight | 512.71 g/mol |
| Exact Mass | 512.26 |
| IUPAC Name | (2E,4S,5R,9S,10Z,12R)-4,10-dimethyl-12-methylsulfonyl-5,9-bis(phenylmethoxy)trideca-2,10-dien-7-one |
| SMILES | C/C=C/[C@H](C)[C@@H](CC(=O)C[C@H](OCc1ccccc1)/C(C)=C\[C@@H](C)S(C)(=O)=O)OCc1ccccc1 |
| InChI | InChI=1S/C30H40O5S/c1-6-13-23(2)29(34-21-26-14-9-7-10-15-26)19-28(31)20-30(24(3)18-25(4)36(5,32)33)35-22-27-16-11-8-12-17-27/h6-18,23,25,29-30H,19-22H2,1-5H3/b13-6+,24-18-/t23-,25+,29+,30-/m0/s1 |
| InChIKey | OFBCUGOETCJNLG-VLXZYNCXSA-N |
| XLogP | 6.10 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.71 |
| LogP ≤ 5 | 6.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|