C17H25N3O3 — CID 110604554
N-[5-(4-formylpiperazin-1-yl)-2-methoxyphenyl]-2,2-dimethylpropanamide (PubChem CID 110604554) has the molecular formula C17H25N3O3 and a molecular weight of 319.41 g/mol. Its IUPAC name is N-[5-(4-formylpiperazin-1-yl)-2-methoxyphenyl]-2,2-dimethylpropanamide.
| Compound Name | N-[5-(4-formylpiperazin-1-yl)-2-methoxyphenyl]-2,2-dimethylpropanamide |
|---|---|
| PubChem CID | 110604554 |
| Molecular Formula | C17H25N3O3 |
| Molecular Weight | 319.41 g/mol |
| Exact Mass | 319.19 |
| IUPAC Name | N-[5-(4-formylpiperazin-1-yl)-2-methoxyphenyl]-2,2-dimethylpropanamide |
| SMILES | COc1ccc(N2CCN(C=O)CC2)cc1NC(=O)C(C)(C)C |
| InChI | InChI=1S/C17H25N3O3/c1-17(2,3)16(22)18-14-11-13(5-6-15(14)23-4)20-9-7-19(12-21)8-10-20/h5-6,11-12H,7-10H2,1-4H3,(H,18,22) |
| InChIKey | JSFMUNQZJLFZQM-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 61.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.41 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|