C18H26N4O4 — CID 110613966
1-[5-(4-formylpiperazin-1-yl)-2-methoxyphenyl]-3-(oxan-4-yl)urea (PubChem CID 110613966) has the molecular formula C18H26N4O4 and a molecular weight of 362.43 g/mol. Its IUPAC name is 1-[5-(4-formylpiperazin-1-yl)-2-methoxyphenyl]-3-(oxan-4-yl)urea.
| Compound Name | 1-[5-(4-formylpiperazin-1-yl)-2-methoxyphenyl]-3-(oxan-4-yl)urea |
|---|---|
| PubChem CID | 110613966 |
| Molecular Formula | C18H26N4O4 |
| Molecular Weight | 362.43 g/mol |
| Exact Mass | 362.20 |
| IUPAC Name | 1-[5-(4-formylpiperazin-1-yl)-2-methoxyphenyl]-3-(oxan-4-yl)urea |
| SMILES | COc1ccc(N2CCN(C=O)CC2)cc1NC(=O)NC1CCOCC1 |
| InChI | InChI=1S/C18H26N4O4/c1-25-17-3-2-15(22-8-6-21(13-23)7-9-22)12-16(17)20-18(24)19-14-4-10-26-11-5-14/h2-3,12-14H,4-11H2,1H3,(H2,19,20,24) |
| InChIKey | JEQMUOSVXGIXQV-UHFFFAOYSA-N |
| XLogP | 1.27 |
| TPSA | 83.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.43 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|