C21H23N5O2 — CID 110606191
3-cyclopropyl-N-[2-[4-(dimethylamino)anilino]-2-oxoethyl]imidazo[1,5-a]pyridine-1-carboxamide (PubChem CID 110606191) has the molecular formula C21H23N5O2 and a molecular weight of 377.45 g/mol. Its IUPAC name is 3-cyclopropyl-N-[2-[4-(dimethylamino)anilino]-2-oxoethyl]imidazo[1,5-a]pyridine-1-carboxamide.
| Compound Name | 3-cyclopropyl-N-[2-[4-(dimethylamino)anilino]-2-oxoethyl]imidazo[1,5-a]pyridine-1-carboxamide |
|---|---|
| PubChem CID | 110606191 |
| Molecular Formula | C21H23N5O2 |
| Molecular Weight | 377.45 g/mol |
| Exact Mass | 377.19 |
| IUPAC Name | 3-cyclopropyl-N-[2-[4-(dimethylamino)anilino]-2-oxoethyl]imidazo[1,5-a]pyridine-1-carboxamide |
| SMILES | CN(C)c1ccc(NC(=O)CNC(=O)c2nc(C3CC3)n3ccccc23)cc1 |
| InChI | InChI=1S/C21H23N5O2/c1-25(2)16-10-8-15(9-11-16)23-18(27)13-22-21(28)19-17-5-3-4-12-26(17)20(24-19)14-6-7-14/h3-5,8-12,14H,6-7,13H2,1-2H3,(H,22,28)(H,23,27) |
| InChIKey | GTVCUMWBMBNORJ-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 78.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.45 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|