C22H23FN2O4 — CID 110606299
(E)-N-[2-(1,3-benzodioxol-5-ylamino)-2-oxoethyl]-3-(4-fluoro-3-methylphenyl)-4-methylpent-2-enamide (PubChem CID 110606299) has the molecular formula C22H23FN2O4 and a molecular weight of 398.43 g/mol. Its IUPAC name is (E)-N-[2-(1,3-benzodioxol-5-ylamino)-2-oxoethyl]-3-(4-fluoro-3-methylphenyl)-4-methylpent-2-enamide.
| Compound Name | (E)-N-[2-(1,3-benzodioxol-5-ylamino)-2-oxoethyl]-3-(4-fluoro-3-methylphenyl)-4-methylpent-2-enamide |
|---|---|
| PubChem CID | 110606299 |
| Molecular Formula | C22H23FN2O4 |
| Molecular Weight | 398.43 g/mol |
| Exact Mass | 398.16 |
| IUPAC Name | (E)-N-[2-(1,3-benzodioxol-5-ylamino)-2-oxoethyl]-3-(4-fluoro-3-methylphenyl)-4-methylpent-2-enamide |
| SMILES | Cc1cc(/C(=C/C(=O)NCC(=O)Nc2ccc3c(c2)OCO3)C(C)C)ccc1F |
| InChI | InChI=1S/C22H23FN2O4/c1-13(2)17(15-4-6-18(23)14(3)8-15)10-21(26)24-11-22(27)25-16-5-7-19-20(9-16)29-12-28-19/h4-10,13H,11-12H2,1-3H3,(H,24,26)(H,25,27)/b17-10+ |
| InChIKey | RYNLYEHXWAPLFT-LICLKQGHSA-N |
| XLogP | 3.66 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.43 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|