C35H42O8SSi — CID 11061298
[(2R,3R,4S,5R,6S)-4,5-dibenzoyloxy-2-[[tert-butyl(dimethyl)silyl]oxymethyl]-6-ethylsulfanyloxan-3-yl] benzoate (PubChem CID 11061298) has the molecular formula C35H42O8SSi and a molecular weight of 650.87 g/mol. Its IUPAC name is [(2R,3R,4S,5R,6S)-4,5-dibenzoyloxy-2-[[tert-butyl(dimethyl)silyl]oxymethyl]-6-ethylsulfanyloxan-3-yl] benzoate.
| Compound Name | [(2R,3R,4S,5R,6S)-4,5-dibenzoyloxy-2-[[tert-butyl(dimethyl)silyl]oxymethyl]-6-ethylsulfanyloxan-3-yl] benzoate |
|---|---|
| PubChem CID | 11061298 |
| Molecular Formula | C35H42O8SSi |
| Molecular Weight | 650.87 g/mol |
| Exact Mass | 650.24 |
| IUPAC Name | [(2R,3R,4S,5R,6S)-4,5-dibenzoyloxy-2-[[tert-butyl(dimethyl)silyl]oxymethyl]-6-ethylsulfanyloxan-3-yl] benzoate |
| SMILES | CCS[C@@H]1O[C@H](CO[Si](C)(C)C(C)(C)C)[C@@H](OC(=O)c2ccccc2)[C@H](OC(=O)c2ccccc2)[C@H]1OC(=O)c1ccccc1 |
| InChI | InChI=1S/C35H42O8SSi/c1-7-44-34-30(43-33(38)26-21-15-10-16-22-26)29(42-32(37)25-19-13-9-14-20-25)28(41-31(36)24-17-11-8-12-18-24)27(40-34)23-39-45(5,6)35(2,3)4/h8-22,27-30,34H,7,23H2,1-6H3/t27-,28-,29+,30-,34+/m1/s1 |
| InChIKey | MQLHROHXQBXRNF-PXJJNHDGSA-N |
| XLogP | 7.16 |
| TPSA | 97.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 650.87 |
| LogP ≤ 5 | 7.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|