C21H30FN3O2 — CID 110617982
3-(2-fluorophenyl)-2-methyl-1-[4-(3-pyrrolidin-1-ylpropanoyl)piperazin-1-yl]propan-1-one (PubChem CID 110617982) has the molecular formula C21H30FN3O2 and a molecular weight of 375.49 g/mol. Its IUPAC name is 3-(2-fluorophenyl)-2-methyl-1-[4-(3-pyrrolidin-1-ylpropanoyl)piperazin-1-yl]propan-1-one.
| Compound Name | 3-(2-fluorophenyl)-2-methyl-1-[4-(3-pyrrolidin-1-ylpropanoyl)piperazin-1-yl]propan-1-one |
|---|---|
| PubChem CID | 110617982 |
| Molecular Formula | C21H30FN3O2 |
| Molecular Weight | 375.49 g/mol |
| Exact Mass | 375.23 |
| IUPAC Name | 3-(2-fluorophenyl)-2-methyl-1-[4-(3-pyrrolidin-1-ylpropanoyl)piperazin-1-yl]propan-1-one |
| SMILES | CC(Cc1ccccc1F)C(=O)N1CCN(C(=O)CCN2CCCC2)CC1 |
| InChI | InChI=1S/C21H30FN3O2/c1-17(16-18-6-2-3-7-19(18)22)21(27)25-14-12-24(13-15-25)20(26)8-11-23-9-4-5-10-23/h2-3,6-7,17H,4-5,8-16H2,1H3 |
| InChIKey | VJSQJIMWTKCBNN-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 43.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.49 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |