About 1-(2-chlorophenyl)-4-(3,3-dimethylmorpholin-4-yl)butane-1,4-dione
1-(2-chlorophenyl)-4-(3,3-dimethylmorpholin-4-yl)butane-1,4-dione (PubChem CID 110624363) has the molecular formula C16H20ClNO3
and a molecular weight of 309.79 g/mol. Its IUPAC name is 1-(2-chlorophenyl)-4-(3,3-dimethylmorpholin-4-yl)butane-1,4-dione.
Molecular Properties
| Compound Name | 1-(2-chlorophenyl)-4-(3,3-dimethylmorpholin-4-yl)butane-1,4-dione |
| PubChem CID | 110624363 |
| Molecular Formula | C16H20ClNO3 |
| Molecular Weight | 309.79 g/mol |
| Exact Mass | 309.11 |
| IUPAC Name | 1-(2-chlorophenyl)-4-(3,3-dimethylmorpholin-4-yl)butane-1,4-dione |
| SMILES | CC1(C)COCCN1C(=O)CCC(=O)c1ccccc1Cl |
| InChI | InChI=1S/C16H20ClNO3/c1-16(2)11-21-10-9-18(16)15(20)8-7-14(19)12-5-3-4-6-13(12)17/h3-6H,7-11H2,1-2H3 |
| InChIKey | CMQKDOGTKZRYAE-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 309.79 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-(2-chlorophenyl)-4-(3,3-dimethylmorpholin-4-yl)butane-1,4-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(2-chlorophenyl)-4-(3,3-dimethylmorpholin-4-yl)butane-1,4-dione?
The IUPAC name of 1-(2-chlorophenyl)-4-(3,3-dimethylmorpholin-4-yl)butane-1,4-dione (CID 110624363) is 1-(2-chlorophenyl)-4-(3,3-dimethylmorpholin-4-yl)butane-1,4-dione.
What is the SMILES notation for 1-(2-chlorophenyl)-4-(3,3-dimethylmorpholin-4-yl)butane-1,4-dione?
The canonical SMILES for 1-(2-chlorophenyl)-4-(3,3-dimethylmorpholin-4-yl)butane-1,4-dione is CC1(C)COCCN1C(=O)CCC(=O)c1ccccc1Cl.
What is the InChIKey of 1-(2-chlorophenyl)-4-(3,3-dimethylmorpholin-4-yl)butane-1,4-dione?
The InChIKey is CMQKDOGTKZRYAE-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H20ClNO3/c1-16(2)11-21-10-9-18(16)15(20)8-7-14(19)12-5-3-4-6-13(12)17/h3-6H,7-11H2,1-2H3.
What are the key properties of 1-(2-chlorophenyl)-4-(3,3-dimethylmorpholin-4-yl)butane-1,4-dione?
1-(2-chlorophenyl)-4-(3,3-dimethylmorpholin-4-yl)butane-1,4-dione has a molecular weight of 309.79 g/mol, XLogP of 2.94, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(2-chlorophenyl)-4-(3,3-dimethylmorpholin-4-yl)butane-1,4-dione is sourced from PubChem (CID 110624363), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).