C18H24N2O3 — CID 110624414
1-phenyl-4-(2,5,5-trimethylmorpholine-4-carbonyl)pyrrolidin-2-one (PubChem CID 110624414) has the molecular formula C18H24N2O3 and a molecular weight of 316.40 g/mol. Its IUPAC name is 1-phenyl-4-(2,5,5-trimethylmorpholine-4-carbonyl)pyrrolidin-2-one.
| Compound Name | 1-phenyl-4-(2,5,5-trimethylmorpholine-4-carbonyl)pyrrolidin-2-one |
|---|---|
| PubChem CID | 110624414 |
| Molecular Formula | C18H24N2O3 |
| Molecular Weight | 316.40 g/mol |
| Exact Mass | 316.18 |
| IUPAC Name | 1-phenyl-4-(2,5,5-trimethylmorpholine-4-carbonyl)pyrrolidin-2-one |
| SMILES | CC1CN(C(=O)C2CC(=O)N(c3ccccc3)C2)C(C)(C)CO1 |
| InChI | InChI=1S/C18H24N2O3/c1-13-10-20(18(2,3)12-23-13)17(22)14-9-16(21)19(11-14)15-7-5-4-6-8-15/h4-8,13-14H,9-12H2,1-3H3 |
| InChIKey | LPSJDDNTDPZEMJ-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.40 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |