C16H29N3O3S — CID 110625685
N-cyclohexyl-1-(cyclopentylsulfamoyl)pyrrolidine-2-carboxamide (PubChem CID 110625685) has the molecular formula C16H29N3O3S and a molecular weight of 343.49 g/mol. Its IUPAC name is N-cyclohexyl-1-(cyclopentylsulfamoyl)pyrrolidine-2-carboxamide.
| Compound Name | N-cyclohexyl-1-(cyclopentylsulfamoyl)pyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 110625685 |
| Molecular Formula | C16H29N3O3S |
| Molecular Weight | 343.49 g/mol |
| Exact Mass | 343.19 |
| IUPAC Name | N-cyclohexyl-1-(cyclopentylsulfamoyl)pyrrolidine-2-carboxamide |
| SMILES | O=C(NC1CCCCC1)C1CCCN1S(=O)(=O)NC1CCCC1 |
| InChI | InChI=1S/C16H29N3O3S/c20-16(17-13-7-2-1-3-8-13)15-11-6-12-19(15)23(21,22)18-14-9-4-5-10-14/h13-15,18H,1-12H2,(H,17,20) |
| InChIKey | GCGIRAXHEPUVRI-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.49 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |