C8H15N3O3S — CID 95134463
(2R)-N-cyclopropyl-1-sulfamoylpyrrolidine-2-carboxamide (PubChem CID 95134463) has the molecular formula C8H15N3O3S and a molecular weight of 233.29 g/mol. Its IUPAC name is (2R)-N-cyclopropyl-1-sulfamoylpyrrolidine-2-carboxamide.
| Compound Name | (2R)-N-cyclopropyl-1-sulfamoylpyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 95134463 |
| Molecular Formula | C8H15N3O3S |
| Molecular Weight | 233.29 g/mol |
| Exact Mass | 233.08 |
| IUPAC Name | (2R)-N-cyclopropyl-1-sulfamoylpyrrolidine-2-carboxamide |
| SMILES | NS(=O)(=O)N1CCC[C@@H]1C(=O)NC1CC1 |
| InChI | InChI=1S/C8H15N3O3S/c9-15(13,14)11-5-1-2-7(11)8(12)10-6-3-4-6/h6-7H,1-5H2,(H,10,12)(H2,9,13,14)/t7-/m1/s1 |
| InChIKey | UPOBGZKUNWGEET-SSDOTTSWSA-N |
| XLogP | -1.07 |
| TPSA | 92.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.29 |
| LogP ≤ 5 | -1.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |