C13H16ClN3O3S — CID 61047413
1-[(2-chloro-3-pyridinyl)sulfonyl]-N-cyclopropylpyrrolidine-2-carboxamide (PubChem CID 61047413) has the molecular formula C13H16ClN3O3S and a molecular weight of 329.81 g/mol. Its IUPAC name is 1-[(2-chloro-3-pyridinyl)sulfonyl]-N-cyclopropylpyrrolidine-2-carboxamide.
| Compound Name | 1-[(2-chloro-3-pyridinyl)sulfonyl]-N-cyclopropylpyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 61047413 |
| Molecular Formula | C13H16ClN3O3S |
| Molecular Weight | 329.81 g/mol |
| Exact Mass | 329.06 |
| IUPAC Name | 1-[(2-chloro-3-pyridinyl)sulfonyl]-N-cyclopropylpyrrolidine-2-carboxamide |
| SMILES | O=C(NC1CC1)C1CCCN1S(=O)(=O)c1cccnc1Cl |
| InChI | InChI=1S/C13H16ClN3O3S/c14-12-11(4-1-7-15-12)21(19,20)17-8-2-3-10(17)13(18)16-9-5-6-9/h1,4,7,9-10H,2-3,5-6,8H2,(H,16,18) |
| InChIKey | OSMIEFBKBJOOID-UHFFFAOYSA-N |
| XLogP | 1.17 |
| TPSA | 79.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.81 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|