C7H14O5 — CID 11062955
(2R,3S)-2,5-bis(hydroxymethyl)-5-methoxyoxolan-3-ol (PubChem CID 11062955) has the molecular formula C7H14O5 and a molecular weight of 178.18 g/mol. Its IUPAC name is (2R,3S)-2,5-bis(hydroxymethyl)-5-methoxyoxolan-3-ol.
| Compound Name | (2R,3S)-2,5-bis(hydroxymethyl)-5-methoxyoxolan-3-ol |
|---|---|
| PubChem CID | 11062955 |
| Molecular Formula | C7H14O5 |
| Molecular Weight | 178.18 g/mol |
| Exact Mass | 178.08 |
| IUPAC Name | (2R,3S)-2,5-bis(hydroxymethyl)-5-methoxyoxolan-3-ol |
| SMILES | COC1(CO)C[C@H](O)[C@@H](CO)O1 |
| InChI | InChI=1S/C7H14O5/c1-11-7(4-9)2-5(10)6(3-8)12-7/h5-6,8-10H,2-4H2,1H3/t5-,6+,7?/m0/s1 |
| InChIKey | BHTSYMHTLRRMDP-GFCOJPQKSA-N |
| XLogP | -1.54 |
| TPSA | 79.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 178.18 |
| LogP ≤ 5 | -1.54 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |