C8H14O4 — CID 69088897
(2S,4S,5R)-5-(hydroxymethyl)-2-prop-1-en-2-yloxolane-2,4-diol (PubChem CID 69088897) has the molecular formula C8H14O4 and a molecular weight of 174.20 g/mol. Its IUPAC name is (2S,4S,5R)-5-(hydroxymethyl)-2-prop-1-en-2-yloxolane-2,4-diol.
| Compound Name | (2S,4S,5R)-5-(hydroxymethyl)-2-prop-1-en-2-yloxolane-2,4-diol |
|---|---|
| PubChem CID | 69088897 |
| Molecular Formula | C8H14O4 |
| Molecular Weight | 174.20 g/mol |
| Exact Mass | 174.09 |
| IUPAC Name | (2S,4S,5R)-5-(hydroxymethyl)-2-prop-1-en-2-yloxolane-2,4-diol |
| SMILES | C=C(C)[C@]1(O)C[C@H](O)[C@@H](CO)O1 |
| InChI | InChI=1S/C8H14O4/c1-5(2)8(11)3-6(10)7(4-9)12-8/h6-7,9-11H,1,3-4H2,2H3/t6-,7+,8-/m0/s1 |
| InChIKey | HABQLERFXREAFJ-RNJXMRFFSA-N |
| XLogP | -0.61 |
| TPSA | 69.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 174.20 |
| LogP ≤ 5 | -0.61 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|