C5H10BrNO3 — CID 18666633
(2R,3S)-5-amino-5-bromo-2-(hydroxymethyl)oxolan-3-ol (PubChem CID 18666633) has the molecular formula C5H10BrNO3 and a molecular weight of 212.04 g/mol. Its IUPAC name is (2R,3S)-5-amino-5-bromo-2-(hydroxymethyl)oxolan-3-ol.
| Compound Name | (2R,3S)-5-amino-5-bromo-2-(hydroxymethyl)oxolan-3-ol |
|---|---|
| PubChem CID | 18666633 |
| Molecular Formula | C5H10BrNO3 |
| Molecular Weight | 212.04 g/mol |
| Exact Mass | 210.98 |
| IUPAC Name | (2R,3S)-5-amino-5-bromo-2-(hydroxymethyl)oxolan-3-ol |
| SMILES | NC1(Br)C[C@H](O)[C@@H](CO)O1 |
| InChI | InChI=1S/C5H10BrNO3/c6-5(7)1-3(9)4(2-8)10-5/h3-4,8-9H,1-2,7H2/t3-,4+,5?/m0/s1 |
| InChIKey | DJGPVTMFJGBSLL-PYHARJCCSA-N |
| XLogP | -0.86 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.04 |
| LogP ≤ 5 | -0.86 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|