C12H14ClIO3 — CID 11245609
(2R,3S,5R)-5-(4-chlorophenyl)-2-(hydroxymethyl)-5-(iodomethyl)oxolan-3-ol (PubChem CID 11245609) has the molecular formula C12H14ClIO3 and a molecular weight of 368.60 g/mol. Its IUPAC name is (2R,3S,5R)-5-(4-chlorophenyl)-2-(hydroxymethyl)-5-(iodomethyl)oxolan-3-ol.
| Compound Name | (2R,3S,5R)-5-(4-chlorophenyl)-2-(hydroxymethyl)-5-(iodomethyl)oxolan-3-ol |
|---|---|
| PubChem CID | 11245609 |
| Molecular Formula | C12H14ClIO3 |
| Molecular Weight | 368.60 g/mol |
| Exact Mass | 367.97 |
| IUPAC Name | (2R,3S,5R)-5-(4-chlorophenyl)-2-(hydroxymethyl)-5-(iodomethyl)oxolan-3-ol |
| SMILES | OC[C@H]1O[C@@](CI)(c2ccc(Cl)cc2)C[C@@H]1O |
| InChI | InChI=1S/C12H14ClIO3/c13-9-3-1-8(2-4-9)12(7-14)5-10(16)11(6-15)17-12/h1-4,10-11,15-16H,5-7H2/t10-,11+,12-/m0/s1 |
| InChIKey | VSKXNDXODBRIFP-TUAOUCFPSA-N |
| XLogP | 2.11 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.60 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|