C16H25NO5S — CID 110633742
6-methoxy-2-[2-(2-methoxyethoxy)ethylsulfonyl]-1-methyl-3,4-dihydro-1H-isoquinoline (PubChem CID 110633742) has the molecular formula C16H25NO5S and a molecular weight of 343.45 g/mol. Its IUPAC name is 6-methoxy-2-[2-(2-methoxyethoxy)ethylsulfonyl]-1-methyl-3,4-dihydro-1H-isoquinoline.
| Compound Name | 6-methoxy-2-[2-(2-methoxyethoxy)ethylsulfonyl]-1-methyl-3,4-dihydro-1H-isoquinoline |
|---|---|
| PubChem CID | 110633742 |
| Molecular Formula | C16H25NO5S |
| Molecular Weight | 343.45 g/mol |
| Exact Mass | 343.15 |
| IUPAC Name | 6-methoxy-2-[2-(2-methoxyethoxy)ethylsulfonyl]-1-methyl-3,4-dihydro-1H-isoquinoline |
| SMILES | COCCOCCS(=O)(=O)N1CCc2cc(OC)ccc2C1C |
| InChI | InChI=1S/C16H25NO5S/c1-13-16-5-4-15(21-3)12-14(16)6-7-17(13)23(18,19)11-10-22-9-8-20-2/h4-5,12-13H,6-11H2,1-3H3 |
| InChIKey | SLPXURKPFXAMEA-UHFFFAOYSA-N |
| XLogP | 1.61 |
| TPSA | 65.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.45 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|