C20H21NO5 — CID 110634843
6-methyl-1-(3,4,5-trimethoxybenzoyl)-2,3-dihydroquinolin-4-one (PubChem CID 110634843) has the molecular formula C20H21NO5 and a molecular weight of 355.39 g/mol. Its IUPAC name is 6-methyl-1-(3,4,5-trimethoxybenzoyl)-2,3-dihydroquinolin-4-one.
| Compound Name | 6-methyl-1-(3,4,5-trimethoxybenzoyl)-2,3-dihydroquinolin-4-one |
|---|---|
| PubChem CID | 110634843 |
| Molecular Formula | C20H21NO5 |
| Molecular Weight | 355.39 g/mol |
| Exact Mass | 355.14 |
| IUPAC Name | 6-methyl-1-(3,4,5-trimethoxybenzoyl)-2,3-dihydroquinolin-4-one |
| SMILES | COc1cc(C(=O)N2CCC(=O)c3cc(C)ccc32)cc(OC)c1OC |
| InChI | InChI=1S/C20H21NO5/c1-12-5-6-15-14(9-12)16(22)7-8-21(15)20(23)13-10-17(24-2)19(26-4)18(11-13)25-3/h5-6,9-11H,7-8H2,1-4H3 |
| InChIKey | SNNCEFSUEUDTCE-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 65.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.39 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |