C18H18N2O2 — CID 19607937
1-(4-aminobenzoyl)-7-methyl-3,4-dihydro-2H-1-benzazepin-5-one (PubChem CID 19607937) has the molecular formula C18H18N2O2 and a molecular weight of 294.35 g/mol. Its IUPAC name is 1-(4-aminobenzoyl)-7-methyl-3,4-dihydro-2H-1-benzazepin-5-one.
| Compound Name | 1-(4-aminobenzoyl)-7-methyl-3,4-dihydro-2H-1-benzazepin-5-one |
|---|---|
| PubChem CID | 19607937 |
| Molecular Formula | C18H18N2O2 |
| Molecular Weight | 294.35 g/mol |
| Exact Mass | 294.14 |
| IUPAC Name | 1-(4-aminobenzoyl)-7-methyl-3,4-dihydro-2H-1-benzazepin-5-one |
| SMILES | Cc1ccc2c(c1)C(=O)CCCN2C(=O)c1ccc(N)cc1 |
| InChI | InChI=1S/C18H18N2O2/c1-12-4-9-16-15(11-12)17(21)3-2-10-20(16)18(22)13-5-7-14(19)8-6-13/h4-9,11H,2-3,10,19H2,1H3 |
| InChIKey | VANPQZRXMCJSDY-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 63.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.35 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|