C20H16N2O4 — CID 110635478
2-[2-(8-methyl-4-oxo-2,3-dihydroquinolin-1-yl)-2-oxoethyl]isoindole-1,3-dione (PubChem CID 110635478) has the molecular formula C20H16N2O4 and a molecular weight of 348.36 g/mol. Its IUPAC name is 2-[2-(8-methyl-4-oxo-2,3-dihydroquinolin-1-yl)-2-oxoethyl]isoindole-1,3-dione.
| Compound Name | 2-[2-(8-methyl-4-oxo-2,3-dihydroquinolin-1-yl)-2-oxoethyl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 110635478 |
| Molecular Formula | C20H16N2O4 |
| Molecular Weight | 348.36 g/mol |
| Exact Mass | 348.11 |
| IUPAC Name | 2-[2-(8-methyl-4-oxo-2,3-dihydroquinolin-1-yl)-2-oxoethyl]isoindole-1,3-dione |
| SMILES | Cc1cccc2c1N(C(=O)CN1C(=O)c3ccccc3C1=O)CCC2=O |
| InChI | InChI=1S/C20H16N2O4/c1-12-5-4-8-15-16(23)9-10-21(18(12)15)17(24)11-22-19(25)13-6-2-3-7-14(13)20(22)26/h2-8H,9-11H2,1H3 |
| InChIKey | OPUOFVNFLWWNDK-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 74.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.36 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|