C23H27NO5 — CID 110635496
8-methyl-1-(3,4,5-triethoxybenzoyl)-2,3-dihydroquinolin-4-one (PubChem CID 110635496) has the molecular formula C23H27NO5 and a molecular weight of 397.47 g/mol. Its IUPAC name is 8-methyl-1-(3,4,5-triethoxybenzoyl)-2,3-dihydroquinolin-4-one.
| Compound Name | 8-methyl-1-(3,4,5-triethoxybenzoyl)-2,3-dihydroquinolin-4-one |
|---|---|
| PubChem CID | 110635496 |
| Molecular Formula | C23H27NO5 |
| Molecular Weight | 397.47 g/mol |
| Exact Mass | 397.19 |
| IUPAC Name | 8-methyl-1-(3,4,5-triethoxybenzoyl)-2,3-dihydroquinolin-4-one |
| SMILES | CCOc1cc(C(=O)N2CCC(=O)c3cccc(C)c32)cc(OCC)c1OCC |
| InChI | InChI=1S/C23H27NO5/c1-5-27-19-13-16(14-20(28-6-2)22(19)29-7-3)23(26)24-12-11-18(25)17-10-8-9-15(4)21(17)24/h8-10,13-14H,5-7,11-12H2,1-4H3 |
| InChIKey | LSVWAXKACCFQRH-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 65.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.47 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |