C13H16N2O — CID 11063847
(1R,5S,8S)-3-diazo-1,8-dimethyl-8-prop-2-enylbicyclo[3.2.1]oct-6-en-2-one (PubChem CID 11063847) has the molecular formula C13H16N2O and a molecular weight of 216.28 g/mol. Its IUPAC name is (1R,5S,8S)-3-diazo-1,8-dimethyl-8-prop-2-enylbicyclo[3.2.1]oct-6-en-2-one.
| Compound Name | (1R,5S,8S)-3-diazo-1,8-dimethyl-8-prop-2-enylbicyclo[3.2.1]oct-6-en-2-one |
|---|---|
| PubChem CID | 11063847 |
| Molecular Formula | C13H16N2O |
| Molecular Weight | 216.28 g/mol |
| Exact Mass | 216.13 |
| IUPAC Name | (1R,5S,8S)-3-diazo-1,8-dimethyl-8-prop-2-enylbicyclo[3.2.1]oct-6-en-2-one |
| SMILES | C=CC[C@@]1(C)[C@@H]2C=C[C@@]1(C)C(=O)C(=[N+]=[N-])C2 |
| InChI | InChI=1S/C13H16N2O/c1-4-6-12(2)9-5-7-13(12,3)11(16)10(8-9)15-14/h4-5,7,9H,1,6,8H2,2-3H3/t9-,12+,13+/m1/s1 |
| InChIKey | HUEMIUDWTAYTQB-ICCXJUOJSA-N |
| XLogP | 2.40 |
| TPSA | 53.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.28 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|