C21H25N3O3S — CID 110640841
6-[4-[(3-methylphenyl)methylsulfonyl]piperazin-1-yl]-3,4-dihydro-1H-quinolin-2-one (PubChem CID 110640841) has the molecular formula C21H25N3O3S and a molecular weight of 399.52 g/mol. Its IUPAC name is 6-[4-[(3-methylphenyl)methylsulfonyl]piperazin-1-yl]-3,4-dihydro-1H-quinolin-2-one.
| Compound Name | 6-[4-[(3-methylphenyl)methylsulfonyl]piperazin-1-yl]-3,4-dihydro-1H-quinolin-2-one |
|---|---|
| PubChem CID | 110640841 |
| Molecular Formula | C21H25N3O3S |
| Molecular Weight | 399.52 g/mol |
| Exact Mass | 399.16 |
| IUPAC Name | 6-[4-[(3-methylphenyl)methylsulfonyl]piperazin-1-yl]-3,4-dihydro-1H-quinolin-2-one |
| SMILES | Cc1cccc(CS(=O)(=O)N2CCN(c3ccc4c(c3)CCC(=O)N4)CC2)c1 |
| InChI | InChI=1S/C21H25N3O3S/c1-16-3-2-4-17(13-16)15-28(26,27)24-11-9-23(10-12-24)19-6-7-20-18(14-19)5-8-21(25)22-20/h2-4,6-7,13-14H,5,8-12,15H2,1H3,(H,22,25) |
| InChIKey | ZUMOBHISWQEVLE-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.52 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|