C13H14N2O2 — CID 110646938
methyl 3,4-dihydro-1H-pyrazino[1,2-a]indole-2-carboxylate (PubChem CID 110646938) has the molecular formula C13H14N2O2 and a molecular weight of 230.27 g/mol. Its IUPAC name is methyl 3,4-dihydro-1H-pyrazino[1,2-a]indole-2-carboxylate.
| Compound Name | methyl 3,4-dihydro-1H-pyrazino[1,2-a]indole-2-carboxylate |
|---|---|
| PubChem CID | 110646938 |
| Molecular Formula | C13H14N2O2 |
| Molecular Weight | 230.27 g/mol |
| Exact Mass | 230.11 |
| IUPAC Name | methyl 3,4-dihydro-1H-pyrazino[1,2-a]indole-2-carboxylate |
| SMILES | COC(=O)N1CCn2c(cc3ccccc32)C1 |
| InChI | InChI=1S/C13H14N2O2/c1-17-13(16)14-6-7-15-11(9-14)8-10-4-2-3-5-12(10)15/h2-5,8H,6-7,9H2,1H3 |
| InChIKey | XATRFHOTYARBKA-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 34.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.27 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |