C21H27N3O — CID 110648962
1-[4-(2,3-dimethylphenyl)piperazin-1-yl]-3-pyridin-3-ylbutan-1-one (PubChem CID 110648962) has the molecular formula C21H27N3O and a molecular weight of 337.47 g/mol. Its IUPAC name is 1-[4-(2,3-dimethylphenyl)piperazin-1-yl]-3-pyridin-3-ylbutan-1-one.
| Compound Name | 1-[4-(2,3-dimethylphenyl)piperazin-1-yl]-3-pyridin-3-ylbutan-1-one |
|---|---|
| PubChem CID | 110648962 |
| Molecular Formula | C21H27N3O |
| Molecular Weight | 337.47 g/mol |
| Exact Mass | 337.22 |
| IUPAC Name | 1-[4-(2,3-dimethylphenyl)piperazin-1-yl]-3-pyridin-3-ylbutan-1-one |
| SMILES | Cc1cccc(N2CCN(C(=O)CC(C)c3cccnc3)CC2)c1C |
| InChI | InChI=1S/C21H27N3O/c1-16-6-4-8-20(18(16)3)23-10-12-24(13-11-23)21(25)14-17(2)19-7-5-9-22-15-19/h4-9,15,17H,10-14H2,1-3H3 |
| InChIKey | CGKVVBWSTAYPAV-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 36.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.47 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |