C7H5N3O3Se — CID 11065092
5-methoxy-4-nitro-2,1,3-benzoselenadiazole (PubChem CID 11065092) has the molecular formula C7H5N3O3Se and a molecular weight of 258.09 g/mol. Its IUPAC name is 5-methoxy-4-nitro-2,1,3-benzoselenadiazole.
| Compound Name | 5-methoxy-4-nitro-2,1,3-benzoselenadiazole |
|---|---|
| PubChem CID | 11065092 |
| Molecular Formula | C7H5N3O3Se |
| Molecular Weight | 258.09 g/mol |
| Exact Mass | 258.95 |
| IUPAC Name | 5-methoxy-4-nitro-2,1,3-benzoselenadiazole |
| SMILES | COc1ccc2n[se]nc2c1[N+](=O)[O-] |
| InChI | InChI=1S/C7H5N3O3Se/c1-13-5-3-2-4-6(9-14-8-4)7(5)10(11)12/h2-3H,1H3 |
| InChIKey | ZKQLMFOUXMVIEA-UHFFFAOYSA-N |
| XLogP | 0.60 |
| TPSA | 78.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.09 |
| LogP ≤ 5 | 0.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|