C18H22N2O4 — CID 110651095
3-pyridin-3-yl-N-(3,4,5-trimethoxyphenyl)butanamide (PubChem CID 110651095) has the molecular formula C18H22N2O4 and a molecular weight of 330.38 g/mol. Its IUPAC name is 3-pyridin-3-yl-N-(3,4,5-trimethoxyphenyl)butanamide.
| Compound Name | 3-pyridin-3-yl-N-(3,4,5-trimethoxyphenyl)butanamide |
|---|---|
| PubChem CID | 110651095 |
| Molecular Formula | C18H22N2O4 |
| Molecular Weight | 330.38 g/mol |
| Exact Mass | 330.16 |
| IUPAC Name | 3-pyridin-3-yl-N-(3,4,5-trimethoxyphenyl)butanamide |
| SMILES | COc1cc(NC(=O)CC(C)c2cccnc2)cc(OC)c1OC |
| InChI | InChI=1S/C18H22N2O4/c1-12(13-6-5-7-19-11-13)8-17(21)20-14-9-15(22-2)18(24-4)16(10-14)23-3/h5-7,9-12H,8H2,1-4H3,(H,20,21) |
| InChIKey | DFPVKOPDVGYECL-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 69.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.38 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |