C21H30N2O2 — CID 110654209
1-(1-tert-butyl-2,5-dimethylpyrrol-3-yl)-2-[2-(4-methoxyphenyl)ethylamino]ethanone (PubChem CID 110654209) has the molecular formula C21H30N2O2 and a molecular weight of 342.48 g/mol. Its IUPAC name is 1-(1-tert-butyl-2,5-dimethylpyrrol-3-yl)-2-[2-(4-methoxyphenyl)ethylamino]ethanone.
| Compound Name | 1-(1-tert-butyl-2,5-dimethylpyrrol-3-yl)-2-[2-(4-methoxyphenyl)ethylamino]ethanone |
|---|---|
| PubChem CID | 110654209 |
| Molecular Formula | C21H30N2O2 |
| Molecular Weight | 342.48 g/mol |
| Exact Mass | 342.23 |
| IUPAC Name | 1-(1-tert-butyl-2,5-dimethylpyrrol-3-yl)-2-[2-(4-methoxyphenyl)ethylamino]ethanone |
| SMILES | COc1ccc(CCNCC(=O)c2cc(C)n(C(C)(C)C)c2C)cc1 |
| InChI | InChI=1S/C21H30N2O2/c1-15-13-19(16(2)23(15)21(3,4)5)20(24)14-22-12-11-17-7-9-18(25-6)10-8-17/h7-10,13,22H,11-12,14H2,1-6H3 |
| InChIKey | AAQZPNLAHPVRKM-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 43.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.48 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|