C21H30N2O4 — CID 110654331
1-(1-tert-butyl-2,5-dimethylpyrrol-3-yl)-2-(3,4,5-trimethoxyanilino)ethanone (PubChem CID 110654331) has the molecular formula C21H30N2O4 and a molecular weight of 374.48 g/mol. Its IUPAC name is 1-(1-tert-butyl-2,5-dimethylpyrrol-3-yl)-2-(3,4,5-trimethoxyanilino)ethanone.
| Compound Name | 1-(1-tert-butyl-2,5-dimethylpyrrol-3-yl)-2-(3,4,5-trimethoxyanilino)ethanone |
|---|---|
| PubChem CID | 110654331 |
| Molecular Formula | C21H30N2O4 |
| Molecular Weight | 374.48 g/mol |
| Exact Mass | 374.22 |
| IUPAC Name | 1-(1-tert-butyl-2,5-dimethylpyrrol-3-yl)-2-(3,4,5-trimethoxyanilino)ethanone |
| SMILES | COc1cc(NCC(=O)c2cc(C)n(C(C)(C)C)c2C)cc(OC)c1OC |
| InChI | InChI=1S/C21H30N2O4/c1-13-9-16(14(2)23(13)21(3,4)5)17(24)12-22-15-10-18(25-6)20(27-8)19(11-15)26-7/h9-11,22H,12H2,1-8H3 |
| InChIKey | SORIOEJWFUPLMZ-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 61.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.48 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|