C20H28N2O3 — CID 110654299
1-(1-tert-butyl-2,5-dimethylpyrrol-3-yl)-2-(3,4-dimethoxyanilino)ethanone (PubChem CID 110654299) has the molecular formula C20H28N2O3 and a molecular weight of 344.46 g/mol. Its IUPAC name is 1-(1-tert-butyl-2,5-dimethylpyrrol-3-yl)-2-(3,4-dimethoxyanilino)ethanone.
| Compound Name | 1-(1-tert-butyl-2,5-dimethylpyrrol-3-yl)-2-(3,4-dimethoxyanilino)ethanone |
|---|---|
| PubChem CID | 110654299 |
| Molecular Formula | C20H28N2O3 |
| Molecular Weight | 344.46 g/mol |
| Exact Mass | 344.21 |
| IUPAC Name | 1-(1-tert-butyl-2,5-dimethylpyrrol-3-yl)-2-(3,4-dimethoxyanilino)ethanone |
| SMILES | COc1ccc(NCC(=O)c2cc(C)n(C(C)(C)C)c2C)cc1OC |
| InChI | InChI=1S/C20H28N2O3/c1-13-10-16(14(2)22(13)20(3,4)5)17(23)12-21-15-8-9-18(24-6)19(11-15)25-7/h8-11,21H,12H2,1-7H3 |
| InChIKey | RKBQYQAHUAYTON-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 52.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.46 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|