C16H30F2O — CID 11065701
(E)-6,6-difluoro-12-[(2-methylpropan-2-yl)oxy]dodec-4-ene (PubChem CID 11065701) has the molecular formula C16H30F2O and a molecular weight of 276.41 g/mol. Its IUPAC name is (E)-6,6-difluoro-12-[(2-methylpropan-2-yl)oxy]dodec-4-ene.
| Compound Name | (E)-6,6-difluoro-12-[(2-methylpropan-2-yl)oxy]dodec-4-ene |
|---|---|
| PubChem CID | 11065701 |
| Molecular Formula | C16H30F2O |
| Molecular Weight | 276.41 g/mol |
| Exact Mass | 276.23 |
| IUPAC Name | (E)-6,6-difluoro-12-[(2-methylpropan-2-yl)oxy]dodec-4-ene |
| SMILES | CCC/C=C/C(F)(F)CCCCCCOC(C)(C)C |
| InChI | InChI=1S/C16H30F2O/c1-5-6-9-12-16(17,18)13-10-7-8-11-14-19-15(2,3)4/h9,12H,5-8,10-11,13-14H2,1-4H3/b12-9+ |
| InChIKey | YQNRTUKZKKTQQZ-FMIVXFBMSA-N |
| XLogP | 5.74 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.41 |
| LogP ≤ 5 | 5.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|