C11H12N6O3S3 — CID 110661636
N-[5-(2-imidazo[2,1-b][1,3]thiazol-6-ylethylsulfamoyl)-1,3,4-thiadiazol-2-yl]acetamide (PubChem CID 110661636) has the molecular formula C11H12N6O3S3 and a molecular weight of 372.46 g/mol. Its IUPAC name is N-[5-(2-imidazo[2,1-b][1,3]thiazol-6-ylethylsulfamoyl)-1,3,4-thiadiazol-2-yl]acetamide.
| Compound Name | N-[5-(2-imidazo[2,1-b][1,3]thiazol-6-ylethylsulfamoyl)-1,3,4-thiadiazol-2-yl]acetamide |
|---|---|
| PubChem CID | 110661636 |
| Molecular Formula | C11H12N6O3S3 |
| Molecular Weight | 372.46 g/mol |
| Exact Mass | 372.01 |
| IUPAC Name | N-[5-(2-imidazo[2,1-b][1,3]thiazol-6-ylethylsulfamoyl)-1,3,4-thiadiazol-2-yl]acetamide |
| SMILES | CC(=O)Nc1nnc(S(=O)(=O)NCCc2cn3ccsc3n2)s1 |
| InChI | InChI=1S/C11H12N6O3S3/c1-7(18)13-9-15-16-11(22-9)23(19,20)12-3-2-8-6-17-4-5-21-10(17)14-8/h4-6,12H,2-3H2,1H3,(H,13,15,18) |
| InChIKey | BYFLZYYDPSDWIE-UHFFFAOYSA-N |
| XLogP | 0.73 |
| TPSA | 118.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.46 |
| LogP ≤ 5 | 0.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'} |
|---|