C18H21N3O — CID 110662556
(3,5-dimethyl-4-phenylpiperazin-1-yl)-pyridin-2-ylmethanone (PubChem CID 110662556) has the molecular formula C18H21N3O and a molecular weight of 295.39 g/mol. Its IUPAC name is (3,5-dimethyl-4-phenylpiperazin-1-yl)-pyridin-2-ylmethanone.
| Compound Name | (3,5-dimethyl-4-phenylpiperazin-1-yl)-pyridin-2-ylmethanone |
|---|---|
| PubChem CID | 110662556 |
| Molecular Formula | C18H21N3O |
| Molecular Weight | 295.39 g/mol |
| Exact Mass | 295.17 |
| IUPAC Name | (3,5-dimethyl-4-phenylpiperazin-1-yl)-pyridin-2-ylmethanone |
| SMILES | CC1CN(C(=O)c2ccccn2)CC(C)N1c1ccccc1 |
| InChI | InChI=1S/C18H21N3O/c1-14-12-20(18(22)17-10-6-7-11-19-17)13-15(2)21(14)16-8-4-3-5-9-16/h3-11,14-15H,12-13H2,1-2H3 |
| InChIKey | JNDFFQLPWOLCPD-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 36.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.39 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |